
CAS 135207-28-2
:Pyrimidine, 4-(chloromethyl)-, hydrochloride (1:1)
Description:
Pyrimidine, 4-(chloromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a chloromethyl group at the 4-position enhances its reactivity, making it useful in various synthetic applications. As a hydrochloride salt, it is typically encountered in a solid form, which is soluble in water and polar organic solvents. This compound is often utilized in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its properties include being a potential electrophile due to the chloromethyl group, which can participate in nucleophilic substitution reactions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structure and reactivity profile make it a valuable intermediate in chemical synthesis.
Formula:C5H5ClN2·ClH
InChI:InChI=1S/C5H5ClN2.ClH/c6-3-5-1-2-7-4-8-5;/h1-2,4H,3H2;1H
InChI key:InChIKey=XBNITCVYWHKCQD-UHFFFAOYSA-N
SMILES:C(Cl)C=1C=CN=CN1.Cl
Synonyms:- Pyrimidine, 4-(chloromethyl)-, hydrochloride (1:1)
- Pyrimidine, 4-(chloromethyl)-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
