CymitQuimica logo

CAS 1352152-46-5

:

5-Bromo-3-fluoro-1-methyl-2(1H)-pyridinone

Description:
5-Bromo-3-fluoro-1-methyl-2(1H)-pyridinone is a heterocyclic organic compound characterized by its pyridinone structure, which features a pyridine ring with a ketone functional group. The presence of bromine and fluorine substituents at specific positions on the ring contributes to its unique chemical properties, including increased reactivity and potential for various chemical transformations. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can influence biological activity. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest for synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-Bromo-3-fluoro-1-methyl-2(1H)-pyridinone is a versatile compound with significant implications in research and industry.
Formula:C6H5BrFNO
InChI:InChI=1S/C6H5BrFNO/c1-9-3-4(7)2-5(8)6(9)10/h2-3H,1H3
InChI key:InChIKey=MQHMCILGEDOEQQ-UHFFFAOYSA-N
SMILES:O=C1C(F)=CC(Br)=CN1C
Synonyms:
  • 2(1H)-Pyridinone, 5-bromo-3-fluoro-1-methyl-
  • 5-Bromo-3-fluoro-1-methyl-2(1H)-pyridinone
  • 5-Bromo-3-fluoro-1-methylpyridin-2(1H)-one
  • 5-Bromo-3-fluoro-1-methylpyridin-2-one
Found 4 products.