CAS 1352208-39-9
:1-(3-Chloro-4-fluorophenyl)-1-hexanone
Description:
1-(3-Chloro-4-fluorophenyl)-1-hexanone is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The presence of a chloro and a fluoro group on the phenyl ring contributes to its unique reactivity and potential applications in various chemical reactions. The hexanone moiety indicates that the compound has a six-carbon alkyl chain attached to the carbonyl group, which influences its physical properties such as boiling point and solubility. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential uses in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of halogen substituents can enhance its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit toxicity or environmental concerns.
Formula:C12H14ClFO
InChI:InChI=1S/C12H14ClFO/c1-2-3-4-5-12(15)9-6-7-11(14)10(13)8-9/h6-8H,2-5H2,1H3
InChI key:InChIKey=BQQNENBNQPAABQ-UHFFFAOYSA-N
SMILES:C(CCCCC)(=O)C1=CC(Cl)=C(F)C=C1
Synonyms:- 1-Hexanone, 1-(3-chloro-4-fluorophenyl)-
- 1-(3-Chloro-4-fluorophenyl)-1-hexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.