CymitQuimica logo

CAS 1352209-80-3

:

1-(5-Chloro-2-methoxyphenyl)-1-heptanone

Description:
1-(5-Chloro-2-methoxyphenyl)-1-heptanone, identified by its CAS number 1352209-80-3, is an organic compound characterized by its structure, which includes a heptanone backbone and a substituted aromatic ring. The presence of a chloro group and a methoxy group on the phenyl ring contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit moderate lipophilicity due to the heptanone chain, which may influence its solubility in organic solvents and its interaction with biological membranes. The chloro substituent can enhance electrophilic reactivity, while the methoxy group may provide electron-donating effects, potentially affecting the compound's overall stability and reactivity. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its specific applications and biological activities would depend on further studies, but compounds with similar structures are often explored in medicinal chemistry and material science.
Formula:C14H19ClO2
InChI:InChI=1S/C14H19ClO2/c1-3-4-5-6-7-13(16)12-10-11(15)8-9-14(12)17-2/h8-10H,3-7H2,1-2H3
InChI key:InChIKey=RTKPBDFBUYEZAR-UHFFFAOYSA-N
SMILES:C(CCCCCC)(=O)C1=C(OC)C=CC(Cl)=C1
Synonyms:
  • 1-Heptanone, 1-(5-chloro-2-methoxyphenyl)-
  • 1-(5-Chloro-2-methoxyphenyl)-1-heptanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.