CAS 1352232-01-9
:1-(4-Chloro-3-methylphenyl)-1-hexanone
Description:
1-(4-Chloro-3-methylphenyl)-1-hexanone, identified by its CAS number 1352232-01-9, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. The structure features a hexanone chain, indicating the presence of a six-carbon aliphatic chain attached to a carbonyl group (C=O). The aromatic ring is substituted with a chlorine atom and a methyl group, which can influence the compound's reactivity and physical properties. This compound is likely to exhibit moderate polarity due to the presence of the carbonyl group, affecting its solubility in various solvents. Additionally, the chlorine substituent may impart unique electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. The presence of both aliphatic and aromatic components suggests that it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C13H17ClO
InChI:InChI=1S/C13H17ClO/c1-3-4-5-6-13(15)11-7-8-12(14)10(2)9-11/h7-9H,3-6H2,1-2H3
InChI key:InChIKey=XHTLWYLXYQZEAE-UHFFFAOYSA-N
SMILES:C(CCCCC)(=O)C1=CC(C)=C(Cl)C=C1
Synonyms:- 1-Hexanone, 1-(4-chloro-3-methylphenyl)-
- 1-(4-Chloro-3-methylphenyl)-1-hexanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.