CAS 1352242-98-8
:3-Thietaneethanamine, 1,1-dioxide
Description:
3-Thietaneethanamine, 1,1-dioxide, also known by its CAS number 1352242-98-8, is a chemical compound characterized by its unique thietane ring structure, which is a five-membered ring containing a sulfur atom. This compound features an amine functional group, contributing to its potential reactivity and interaction with other chemical species. The presence of the 1,1-dioxide indicates that there are two oxygen atoms double-bonded to the sulfur atom, which can influence the compound's polarity and solubility in various solvents. Typically, compounds of this nature may exhibit properties such as moderate volatility and potential biological activity, making them of interest in medicinal chemistry and materials science. Additionally, the thietane ring can impart strain, which may lead to interesting reactivity patterns. Overall, the characteristics of 3-Thietaneethanamine, 1,1-dioxide suggest a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C5H11NO2S
InChI:InChI=1S/C5H11NO2S/c6-2-1-5-3-9(7,8)4-5/h5H,1-4,6H2
InChI key:InChIKey=WUZLHCPAXJNLGF-UHFFFAOYSA-N
SMILES:C(CN)C1CS(=O)(=O)C1
Synonyms:- 2-(1,1-Dioxothietan-3-yl)ethylamine
- 3-Thietaneethanamine, 1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.