CAS 13523-62-1

2-ISOPROPYL-4-HYDROXY ANISOLE

Description:

2-Isopropyl-4-hydroxyanisole, also known as BHA (butylated hydroxyanisole), is an organic compound characterized by its aromatic structure, which includes a methoxy group and a hydroxyl group attached to a benzene ring. This compound is a derivative of anisole and is primarily used as an antioxidant in food and cosmetic products to prevent oxidative degradation. It exhibits properties such as being a white to pale yellow crystalline solid with a characteristic odor. The compound is soluble in organic solvents and has limited solubility in water. Its antioxidant activity is attributed to the presence of the hydroxyl group, which can donate hydrogen atoms to free radicals, thereby stabilizing them. Additionally, 2-isopropyl-4-hydroxyanisole is recognized for its potential health effects, leading to regulatory scrutiny in various applications. Overall, its chemical stability and effectiveness as an antioxidant make it a valuable additive in various industries, although its use is subject to specific regulations due to safety considerations.

Formula: C₁₀H₁₄O₂

InChI: InChI=1/C10H14O2/c1-7(2)9-6-8(11)4-5-10(9)12-3/h4-7,11H,1-3H3

SMILES: CC(C)c1cc(ccc1OC)O

Synonyms:

• 3-Isopropyl-4-methoxyphenol
• Phenol, 4-methoxy-3-(1-methylethyl)-
• 4-Methoxy-3-(Propan-2-Yl)Phenol