
CAS 1352305-16-8
:2-[4-(Trifluoromethyl)phenyl]-2H-[1,3]dioxolo[4,5-f]indazole
Description:
2-[4-(Trifluoromethyl)phenyl]-2H-[1,3]dioxolo[4,5-f]indazole is a synthetic organic compound characterized by its complex molecular structure, which includes a dioxole ring fused to an indazole moiety. The presence of a trifluoromethyl group on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential pharmacological applications. Its unique structure may confer specific interactions with biological targets, making it a candidate for further investigation in drug development. Additionally, the presence of fluorine atoms often imparts stability and alters the reactivity of the compound, which can be advantageous in various chemical reactions. As with many fluorinated compounds, it is essential to consider environmental and safety aspects during handling and disposal. Overall, 2-[4-(Trifluoromethyl)phenyl]-2H-[1,3]dioxolo[4,5-f]indazole represents a valuable compound in the field of chemical research.
Formula:C15H9F3N2O2
InChI:InChI=1S/C15H9F3N2O2/c16-15(17,18)10-1-3-11(4-2-10)20-7-9-5-13-14(22-8-21-13)6-12(9)19-20/h1-7H,8H2
InChI key:InChIKey=AZKCCGDFLWYBSJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC=C(N2C=C3C(=N2)C=C4C(=C3)OCO4)C=C1
Synonyms:- 2-[4-(Trifluoromethyl)phenyl]-2H-[1,3]dioxolo[4,5-f]indazole
- 2H-[1,3]Dioxolo[4,5-f]indazole, 2-[4-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.