CymitQuimica logo

CAS 1352305-23-7

:

2-(2-Pyridinyl)-2H-[1,3]dioxolo[4,5-f]indazole

Description:
2-(2-Pyridinyl)-2H-[1,3]dioxolo[4,5-f]indazole is a chemical compound characterized by its unique structural features, which include a pyridine ring and a dioxole moiety fused to an indazole framework. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the pyridine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the dioxole structure may contribute to its stability and reactivity. The compound's molecular structure can influence its electronic properties, potentially affecting its behavior in chemical reactions and interactions with other molecules. As with many heterocycles, it may exhibit fluorescence or other optical properties, depending on its specific electronic configuration. Overall, 2-(2-Pyridinyl)-2H-[1,3]dioxolo[4,5-f]indazole represents a class of compounds that may have applications in pharmaceuticals or materials science, warranting further investigation into its properties and potential uses.
Formula:C13H9N3O2
InChI:InChI=1S/C13H9N3O2/c1-2-4-14-13(3-1)16-7-9-5-11-12(18-8-17-11)6-10(9)15-16/h1-7H,8H2
InChI key:InChIKey=UAYSKYCYSVTGKR-UHFFFAOYSA-N
SMILES:C=12C(=NN(C1)C3=CC=CC=N3)C=C4C(=C2)OCO4
Synonyms:
  • 2H-[1,3]Dioxolo[4,5-f]indazole, 2-(2-pyridinyl)-
  • 2-(2-Pyridinyl)-2H-[1,3]dioxolo[4,5-f]indazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.