CymitQuimica logo

CAS 1352305-27-1

:

Imidazo[1,2-a]pyrazine-6-methanamine, hydrochloride (1:2)

Description:
Imidazo[1,2-a]pyrazine-6-methanamine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyrazine rings. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the methanamine group contributes to its basicity and potential reactivity, making it of interest in various chemical and pharmaceutical applications. Its molecular structure allows for potential interactions with biological targets, which may be explored in drug development. As a hydrochloride salt, it is often used to improve the pharmacokinetic properties of the base compound. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a class of heterocyclic compounds that may exhibit diverse biological activities, warranting further investigation in medicinal chemistry.
Formula:C7H8N4·2ClH
InChI:InChI=1S/C7H8N4.2ClH/c8-3-6-5-11-2-1-9-7(11)4-10-6;;/h1-2,4-5H,3,8H2;2*1H
InChI key:InChIKey=WMQSEFDZOZYILP-UHFFFAOYSA-N
SMILES:C(N)C1=CN2C(C=N1)=NC=C2.Cl
Synonyms:
  • Imidazo[1,2-a]pyrazine-6-methanamine, hydrochloride (1:2)
Found 3 products.