
CAS 1352305-28-2
:Description:
The chemical substance with the CAS number 1352305-28-2 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular weight, solubility, boiling and melting points, and reactivity, which are determined by their molecular structure and functional groups. Such substances may be used in various applications, including pharmaceuticals, agrochemicals, or materials science, depending on their chemical nature. To obtain precise characteristics, including safety data, handling procedures, and potential applications, it is advisable to consult specialized chemical databases, safety data sheets (SDS), or scientific literature. Additionally, the context of its use, such as whether it is a reagent, intermediate, or final product, can significantly influence its properties and relevance in research or industry.
Formula:C15H17N3O
InChI:InChI=1S/C15H17N3O/c1-2-19-11-6-3-5-10(9-11)15-17-13-8-4-7-12(13)14(16)18-15/h3,5-6,9H,2,4,7-8H2,1H3,(H2,16,17,18)
InChI key:InChIKey=FWBZTROJOGLWSU-UHFFFAOYSA-N
SMILES:NC=1N=C(N=C2C1CCC2)C3=CC(OCC)=CC=C3
Synonyms:- 2-(3-Ethoxyphenyl)-5H,6H,7H-cyclopenta[d]pyrimidin-4-amine
- 4-Amino-2-(3-ethoxyphenyl)-6,7-dihydro-5H-cyclopenta[D]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.