CAS 1352306-34-3
:2-Fluoro-3,6-dimethoxybenzoic acid
Description:
2-Fluoro-3,6-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and two methoxy groups attached to a benzene ring. The fluorine substituent is located at the 2-position, while the methoxy groups are positioned at the 3 and 6 positions of the aromatic ring. This compound exhibits typical properties of benzoic acids, including acidity due to the carboxylic acid functional group, which can donate protons in solution. The presence of the electronegative fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its solubility in polar solvents. The methoxy groups contribute to the compound's overall electron-donating character, which can affect its chemical behavior and interactions with other molecules. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its unique structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research and development.
Formula:C9H9FO4
InChI:InChI=1S/C9H9FO4/c1-13-5-3-4-6(14-2)8(10)7(5)9(11)12/h3-4H,1-2H3,(H,11,12)
InChI key:InChIKey=KKXGHSOLMUAXJH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC)C=CC(OC)=C1F
Synonyms:- Benzoic acid, 2-fluoro-3,6-dimethoxy-
- 2-Fluoro-3,6-dimethoxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.