CAS 1352317-78-2
:4′-Chloro-2′-methoxy[1,1′-biphenyl]-3-carbonitrile
Description:
4′-Chloro-2′-methoxy[1,1′-biphenyl]-3-carbonitrile, identified by its CAS number 1352317-78-2, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the para position and a methoxy group at the ortho position relative to the carbonitrile functional group contributes to its chemical reactivity and potential applications. The carbonitrile group (-C≡N) is known for its ability to participate in nucleophilic reactions, making this compound of interest in synthetic organic chemistry. Additionally, the methoxy group can influence the compound's solubility and electronic properties, while the chloro substituent may enhance its reactivity towards electrophiles. This compound may be utilized in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features. Overall, its distinct functional groups and biphenyl framework suggest potential utility in further chemical transformations and applications.
Formula:C14H10ClNO
InChI:InChI=1S/C14H10ClNO/c1-17-14-8-12(15)5-6-13(14)11-4-2-3-10(7-11)9-16/h2-8H,1H3
InChI key:InChIKey=XURVKMUZOQWBPD-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=CC(C#N)=CC=C2)C=CC(Cl)=C1
Synonyms:- [1,1′-Biphenyl]-3-carbonitrile, 4′-chloro-2′-methoxy-
- 4′-Chloro-2′-methoxy[1,1′-biphenyl]-3-carbonitrile
- 3-(4-Chloro-2-methoxyphenyl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.