CAS 1352317-80-6

1-Bromo-2-fluoro-4-methoxy-3-nitrobenzene

Description:

1-Bromo-2-fluoro-4-methoxy-3-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, a methoxy group, and a nitro group attached to a benzene ring. The molecular structure features a bromine substituent at the first position, a fluorine at the second, a methoxy group (-OCH3) at the fourth position, and a nitro group (-NO2) at the third position of the benzene ring. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents and varying melting and boiling points depending on its purity and specific conditions. The presence of both electron-withdrawing (nitro) and electron-donating (methoxy) groups can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, its unique combination of substituents may impart specific biological activities, making it of interest in medicinal chemistry and material science.

Formula: C₇H₅BrFNO₃

InChI: InChI=1S/C7H5BrFNO3/c1-13-5-3-2-4(8)6(9)7(5)10(11)12/h2-3H,1H3

InChI key: InChIKey=LJJAOMRFFXQENV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(OC)C=CC(Br)=C1F

Synonyms:

• 1-Bromo-2-fluoro-4-methoxy-3-nitrobenzene
• Benzene, 1-bromo-2-fluoro-4-methoxy-3-nitro-
• 4-Bromo-3-fluoro-2-nitroanisole

1-Bromo-2-fluoro-4-methoxy-3-nitrobenzene

CAS: 1352317-80-6

Formula: C₇H₅BrFNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 250.0219

Ref: IN-DA007LHV

4-Bromo-3-fluoro-2-nitroanisole

CAS: 1352317-80-6

4-Bromo-3-fluoro-2-nitroanisole

Purity: 98%

Molecular weight: 250.02g/mol

Ref: 54-PC101137

1-Bromo-2-fluoro-4-methoxy-3-nitrobenzene

CAS: 1352317-80-6

Formula: C₇H₅BrFNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 250.023

Ref: 10-F460873

4-Bromo-3-fluoro-2-nitroanisole

CAS: 1352317-80-6

4-Bromo-3-fluoro-2-nitroanisole is a synthetic amide that has been studied for its potential use as a biomarker for inflammatory diseases. It is also being investigated as a therapeutic agent for autoimmune and infectious diseases, such as alopecia areata and metastatic colorectal cancer. 4-Bromo-3-fluoro-2-nitroanisole binds to the receptor PDL1, which is found on immune cells such as T cells and B cells. This binding inhibits the production of immune cells by blocking the growth factor activity of PDL1. The compound has also shown some antiinflammatory properties in mice with skin inflammation.

Formula: C₇H₅BrFNO₃

Purity: Min. 95%

Molecular weight: 250.02 g/mol

Ref: 3D-CEC31780