CAS 1352317-81-7

Methyl 2′-cyano-3-fluoro[1,1′-biphenyl]-4-carboxylate

Description:

Methyl 2′-cyano-3-fluoro[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a fluoro group (-F) on the biphenyl framework contributes to its chemical reactivity and polarity. The carboxylate functional group (-COOCH3) indicates that it is an ester, which can influence its solubility and reactivity in various chemical environments. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it potentially useful in pharmaceuticals or materials science. Its molecular structure suggests that it could participate in nucleophilic substitution reactions or serve as a precursor for further chemical modifications. Additionally, the presence of the cyano and fluoro substituents may enhance its stability and alter its electronic properties, which can be significant in applications such as organic electronics or agrochemicals. Overall, this compound represents a versatile building block in synthetic organic chemistry.

Formula: C₁₅H₁₀FNO₂

InChI: InChI=1S/C15H10FNO2/c1-19-15(18)13-7-6-10(8-14(13)16)12-5-3-2-4-11(12)9-17/h2-8H,1H3

InChI key: InChIKey=OOFHUTKSKDYNEV-UHFFFAOYSA-N

SMILES: C(#N)C1=C(C=CC=C1)C2=CC(F)=C(C(OC)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 2′-cyano-3-fluoro-, methyl ester
• Methyl 2′-cyano-3-fluoro[1,1′-biphenyl]-4-carboxylate

Methyl 4-(2-cyanophenyl)-2-fluorobenzoate

CAS: 1352317-81-7

Formula: C₁₅H₁₀FNO₂

Molecular weight: 255.2438

Ref: IN-DA007ZOE