CymitQuimica logo

CAS 1352317-82-8

:

2′-Cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid

Description:
2′-Cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a carboxylic acid group (-COOH) contributes to its reactivity and potential applications in various chemical reactions. The fluoro substituent at the 5-position enhances the compound's electronic properties, potentially influencing its behavior in biological systems or as a ligand in coordination chemistry. This compound may exhibit polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding. Additionally, the cyano group can act as an electron-withdrawing group, affecting the acidity and reactivity of the carboxylic acid. Overall, 2′-Cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science, although specific applications would depend on further research and development.
Formula:C14H8FNO2
InChI:InChI=1S/C14H8FNO2/c15-12-6-10(5-11(7-12)14(17)18)13-4-2-1-3-9(13)8-16/h1-7H,(H,17,18)
InChI key:InChIKey=YODBSTTVOCZOPQ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=C1)C2=CC(C(O)=O)=CC(F)=C2
Synonyms:
  • 2′-Cyano-5-fluoro[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′-cyano-5-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.