CAS 1352317-91-9: 4-Fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylic acid

Description:4-Fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group (-COOH) at the 3-position contributes to its acidic properties, while the fluoro (-F) and nitro (-NO2) substituents at the 4-positions enhance its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The presence of the nitro group can also impart unique electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous. Overall, 4-Fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with significant implications in chemical research and industry.

Formula:C₁₃H₈FNO₄

InChI:InChI=1S/C13H8FNO4/c14-12-6-3-9(7-11(12)13(16)17)8-1-4-10(5-2-8)15(18)19/h1-7H,(H,16,17)

InChI key:InChIKey=AKNKDVHVOKJUMJ-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=C(C=CC1F)C2=CC=C(C=C2)N(=O)=O

Synonyms:
4-Fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylic acid
[1,1′-Biphenyl]-3-carboxylic acid, 4-fluoro-4′-nitro-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	2-Fluoro-5-(4-nitrophenyl)benzoic acid REF: 10-F638718CAS: 1352317-91-9	95%	- - -	Discontinued product
	2-Fluoro-5-(4-nitrophenyl)benzoic acid REF: 3D-CEC31791CAS: 1352317-91-9	Min. 95%	- - -	Discontinued product