
CAS 1352318-07-0
:Pyridine, 3-bromo-2-(1-piperidinyl)-, hydrochloride (1:1)
Description:
Pyridine, 3-bromo-2-(1-piperidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a piperidinyl group at the 2-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, making it useful in various chemical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmacological studies due to its structural features. Its molecular interactions can be influenced by the presence of the bromine substituent and the piperidinyl moiety, which may affect its binding affinity in biological systems. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C10H13BrN2·ClH
InChI:InChI=1S/C10H13BrN2.ClH/c11-9-5-4-6-12-10(9)13-7-2-1-3-8-13;/h4-6H,1-3,7-8H2;1H
InChI key:InChIKey=PFBKQTKAJDILMJ-UHFFFAOYSA-N
SMILES:BrC1=C(N2CCCCC2)N=CC=C1.Cl
Synonyms:- Pyridine, 3-bromo-2-(1-piperidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.