CAS 1352318-11-6
:2-(Dimethoxymethyl)-3-methoxynaphthalene
Description:
2-(Dimethoxymethyl)-3-methoxynaphthalene, identified by its CAS number 1352318-11-6, is an organic compound characterized by its complex structure, which includes a naphthalene core substituted with methoxy and dimethoxymethyl groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of electron-donating methoxy groups. The methoxy substituents can influence the compound's solubility, reactivity, and interaction with other molecules, making it of interest in fields such as organic synthesis and materials science. Additionally, the presence of multiple methoxy groups can enhance the compound's hydrophobic characteristics, affecting its behavior in different solvents. Its unique structure may also impart specific optical or electronic properties, which could be valuable in applications like organic electronics or as intermediates in the synthesis of more complex molecules. However, detailed information regarding its specific physical and chemical properties, such as melting point, boiling point, and spectral data, would require further investigation or experimental data.
Formula:C14H16O3
InChI:InChI=1S/C14H16O3/c1-15-13-9-11-7-5-4-6-10(11)8-12(13)14(16-2)17-3/h4-9,14H,1-3H3
InChI key:InChIKey=ZWXYMZAXVVUMGL-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C(OC)=CC2=C(C1)C=CC=C2
Synonyms:- Naphthalene, 2-(dimethoxymethyl)-3-methoxy-
- 2-(Dimethoxymethyl)-3-methoxynaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.