CAS 1352318-19-4

1-(4′-Chloro-2′-methoxy[1,1′-biphenyl]-3-yl)ethanone

Description:

1-(4′-Chloro-2′-methoxy[1,1′-biphenyl]-3-yl)ethanone, with the CAS number 1352318-19-4, is an organic compound characterized by its biphenyl structure, which features a chloro and a methoxy substituent. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. The presence of the chloro group can influence its electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. The methoxy group, being an electron-donating substituent, may also affect the compound's solubility and polarity. In terms of applications, compounds with similar structures are often investigated for their potential biological activities, including antimicrobial or anti-inflammatory properties. Additionally, the presence of the ethanone functional group suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Overall, this compound's unique structural features contribute to its potential utility in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₅H₁₃ClO₂

InChI: InChI=1S/C15H13ClO2/c1-10(17)11-4-3-5-12(8-11)14-7-6-13(16)9-15(14)18-2/h3-9H,1-2H3

InChI key: InChIKey=GSMSCZFMFKJYHZ-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(Cl)=C1)C2=CC(C(C)=O)=CC=C2

Synonyms:

• 1-(4′-Chloro-2′-methoxy[1,1′-biphenyl]-3-yl)ethanone
• Ethanone, 1-(4′-chloro-2′-methoxy[1,1′-biphenyl]-3-yl)-

1-[3-(4-chloro-2-methoxyphenyl)phenyl]ethanone

CAS: 1352318-19-4

Formula: C₁₅H₁₃ClO₂

Molecular weight: 260.7155

Ref: IN-DA006ZCG