CAS 1352318-21-8

4′-Fluoro-3′-methyl[1,1′-biphenyl]-3-acetic acid

Description:

4′-Fluoro-3′-methyl[1,1′-biphenyl]-3-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the para position and a methyl group at the meta position on one of the phenyl rings contributes to its unique chemical properties. This compound features a carboxylic acid functional group, which imparts acidic characteristics and enhances its solubility in polar solvents. The molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly due to the presence of the fluoro substituent, which can influence biological activity and reactivity. Additionally, the compound's stability and reactivity can be affected by the steric and electronic effects of the substituents. Overall, 4′-Fluoro-3′-methyl[1,1′-biphenyl]-3-acetic acid exemplifies the complexity of biphenyl derivatives and their potential utility in various chemical applications.

Formula: C₁₅H₁₃FO₂

InChI: InChI=1S/C15H13FO2/c1-10-7-13(5-6-14(10)16)12-4-2-3-11(8-12)9-15(17)18/h2-8H,9H2,1H3,(H,17,18)

InChI key: InChIKey=RMAXSBLCFRGNIC-UHFFFAOYSA-N

SMILES: CC=1C=C(C=CC1F)C2=CC(CC(O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-acetic acid, 4′-fluoro-3′-methyl-
• 4′-Fluoro-3′-methyl[1,1′-biphenyl]-3-acetic acid

3-(4-Fluoro-3-methylphenyl)phenylacetic acid

CAS: 1352318-21-8

Formula: C₁₅H₁₃FO₂

Molecular weight: 244.2609

Ref: IN-DA006ZCF