CAS 1352318-30-9

[1,1′-Biphenyl]-3-amine, 3′-chloro-4′-methyl-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-3-amine, 3′-chloro-4′-methyl-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an amine group at the 3-position of one phenyl ring and a chloro and methyl substituent at the 3′ and 4′ positions of the other phenyl ring, respectively, contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit biological activity due to the presence of the amine group, potentially interacting with biological targets. Its molecular structure suggests potential uses in the development of dyes, agrochemicals, or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₂ClN·ClH

InChI: InChI=1S/C13H12ClN.ClH/c1-9-5-6-11(8-13(9)14)10-3-2-4-12(15)7-10;/h2-8H,15H2,1H3;1H

InChI key: InChIKey=CVHYEQPWUVBZQW-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C)C2=CC(N)=CC=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-3-amine, 3′-chloro-4′-methyl-, hydrochloride (1:1)