CAS 1352318-32-1

[1,1′-Biphenyl]-3-amine, 3′-fluoro-4′-methyl-, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-3-amine, 3′-fluoro-4′-methyl-, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an amino group at the 3-position of one phenyl ring and a fluoro and methyl substituent at the 3′ and 4′ positions of the other ring contributes to its unique reactivity and potential applications in pharmaceuticals or organic synthesis. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its usability in various chemical processes. The compound may exhibit specific biological activities due to its functional groups, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the presence of the fluorine atom, which can affect electronic properties and steric hindrance. Overall, this compound represents a class of organic molecules that can be explored for diverse applications in research and industry.

Formula: C₁₃H₁₂FN·ClH

InChI: InChI=1S/C13H12FN.ClH/c1-9-5-6-11(8-13(9)14)10-3-2-4-12(15)7-10;/h2-8H,15H2,1H3;1H

InChI key: InChIKey=RMGDMUKLHZRAJL-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C)C2=CC(N)=CC=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-3-amine, 3′-fluoro-4′-methyl-, hydrochloride (1:1)