CAS 1352318-33-2
:3′-Chloro-4′-methyl[1,1′-biphenyl]-3-acetic acid
Description:
3′-Chloro-4′-methyl[1,1′-biphenyl]-3-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a methyl group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties. This compound features an acetic acid functional group, which imparts acidic characteristics and can participate in various chemical reactions, such as esterification or amidation. The molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific interactions and reactivity can be influenced by the substituents on the biphenyl framework, making it a subject of interest in medicinal chemistry and materials science. Additionally, the compound's solubility, stability, and biological activity would depend on its molecular interactions and the environment in which it is used.
Formula:C15H13ClO2
InChI:InChI=1S/C15H13ClO2/c1-10-5-6-13(9-14(10)16)12-4-2-3-11(7-12)8-15(17)18/h2-7,9H,8H2,1H3,(H,17,18)
InChI key:InChIKey=KDKWTLORQWKWSX-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1C)C2=CC(CC(O)=O)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-acetic acid, 3′-chloro-4′-methyl-
- 3′-Chloro-4′-methyl[1,1′-biphenyl]-3-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.