CAS 1352318-40-1
:1,1′-Biphenyl, 4-fluoro-3-methyl-4′-nitro-
Description:
1,1′-Biphenyl, 4-fluoro-3-methyl-4′-nitro- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the para position of one phenyl ring, a methyl group at the meta position, and a nitro group at the para position of the other phenyl ring contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine and nitro groups, which can influence its solubility in various solvents. Additionally, the nitro group may impart some degree of reactivity, making it a potential candidate for further chemical transformations. The compound's molecular structure suggests it may have applications in materials science, pharmaceuticals, or as an intermediate in organic synthesis. Safety and handling precautions should be observed, as nitro compounds can be sensitive and potentially hazardous. Overall, the specific characteristics of this compound would depend on its physical state, purity, and the conditions under which it is used.
Formula:C13H10FNO2
InChI:InChI=1S/C13H10FNO2/c1-9-8-11(4-7-13(9)14)10-2-5-12(6-3-10)15(16)17/h2-8H,1H3
InChI key:InChIKey=HPLQKYKRWQAUCQ-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1F)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 1-Fluoro-2-methyl-4-(4-nitrophenyl)benzene
- 1,1′-Biphenyl, 4-fluoro-3-methyl-4′-nitro-
- 4-Fluoro-3-methyl-4′-nitro-1,1′-biphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.