CymitQuimica logo

CAS 1352318-43-4

:

3′-Fluoro-4′-methyl[1,1′-biphenyl]-3-carbonitrile

Description:
3′-Fluoro-4′-methyl[1,1′-biphenyl]-3-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a methyl group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties. Additionally, the cyano group (-C≡N) at the 3 position enhances its reactivity and polarity, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its molecular structure allows for potential interactions with biological targets, which can be explored in medicinal chemistry. The presence of halogen and cyano functionalities often indicates potential for further derivatization, making it a valuable intermediate in synthetic organic chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to ensure proper laboratory practices.
Formula:C14H10FN
InChI:InChI=1S/C14H10FN/c1-10-5-6-13(8-14(10)15)12-4-2-3-11(7-12)9-16/h2-8H,1H3
InChI key:InChIKey=AGTSDCJWBCGXRP-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C)C2=CC(C#N)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carbonitrile, 3′-fluoro-4′-methyl-
  • 3′-Fluoro-4′-methyl[1,1′-biphenyl]-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.