CAS 1352318-48-9
:Methyl 2′-cyano-5-fluoro[1,1′-biphenyl]-3-carboxylate
Description:
Methyl 2′-cyano-5-fluoro[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a fluoro group (-F) on the biphenyl framework contributes to its chemical reactivity and polarity. The carboxylate functional group, indicated by the -COOCH3 moiety, suggests that this compound can participate in various chemical reactions, including esterification and nucleophilic substitutions. The methyl ester form enhances its solubility in organic solvents, making it useful in synthetic applications. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, the presence of the cyano and fluoro substituents can impart unique electronic properties, potentially affecting its behavior in chemical reactions and interactions. Overall, Methyl 2′-cyano-5-fluoro[1,1′-biphenyl]-3-carboxylate is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C15H10FNO2
InChI:InChI=1S/C15H10FNO2/c1-19-15(18)12-6-11(7-13(16)8-12)14-5-3-2-4-10(14)9-17/h2-8H,1H3
InChI key:InChIKey=UINKSZBRWJPBBA-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=C1)C2=CC(C(OC)=O)=CC(F)=C2
Synonyms:- Methyl 2′-cyano-5-fluoro[1,1′-biphenyl]-3-carboxylate
- [1,1′-Biphenyl]-3-carboxylic acid, 2′-cyano-5-fluoro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
