CymitQuimica logo

CAS 1352318-51-4

:

N-(1,1-Dimethylethyl)-4-nitro-2-(trifluoromethoxy)benzenamine

Description:
N-(1,1-Dimethylethyl)-4-nitro-2-(trifluoromethoxy)benzenamine is an organic compound characterized by its complex structure, which includes a nitro group and a trifluoromethoxy substituent on a benzene ring. The presence of the bulky tert-butyl group (1,1-dimethylethyl) enhances its steric properties, potentially influencing its reactivity and solubility. The nitro group is known for its electron-withdrawing effects, which can affect the compound's electronic properties and reactivity in various chemical reactions. The trifluoromethoxy group contributes to the compound's lipophilicity and may enhance its biological activity. This compound may be of interest in pharmaceutical research or materials science due to its unique functional groups, which can participate in various chemical transformations. Its CAS number, 1352318-51-4, allows for precise identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and agrochemicals. Overall, the combination of these functional groups suggests potential utility in diverse chemical applications.
Formula:C11H13F3N2O3
InChI:InChI=1S/C11H13F3N2O3/c1-10(2,3)15-8-5-4-7(16(17)18)6-9(8)19-11(12,13)14/h4-6,15H,1-3H3
InChI key:InChIKey=DJNGJEYVRZPVIX-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(NC(C)(C)C)C=CC(N(=O)=O)=C1
Synonyms:
  • Benzenamine, N-(1,1-dimethylethyl)-4-nitro-2-(trifluoromethoxy)-
  • N-(1,1-Dimethylethyl)-4-nitro-2-(trifluoromethoxy)benzenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.