
CAS 1352318-53-6
:Benzeneethanamine, 3-chloro-β,β-dimethyl-, hydrochloride (1:1)
Description:
Benzeneethanamine, 3-chloro-β,β-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a chloro substituent on the benzene ring. This compound features a benzeneethanamine backbone, which is a derivative of phenethylamine, and includes two methyl groups at the β position relative to the amine group. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions in biological systems. Its structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific biological activities, toxicity, and regulatory status would require further investigation, as these factors can vary significantly based on the compound's use and formulation.
Formula:C10H14ClN·ClH
InChI:InChI=1S/C10H14ClN.ClH/c1-10(2,7-12)8-4-3-5-9(11)6-8;/h3-6H,7,12H2,1-2H3;1H
InChI key:InChIKey=NIQONYOEFCGXGC-UHFFFAOYSA-N
SMILES:C(CN)(C)(C)C1=CC(Cl)=CC=C1.Cl
Synonyms:- Benzeneethanamine, 3-chloro-β,β-dimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.