CAS 1352318-54-7

4′-Nitro[1,1′-biphenyl]-3-carbonitrile

Description:

4′-Nitro[1,1′-biphenyl]-3-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a nitro group (-NO2) at the para position relative to the carbonitrile group (-C≡N) on one of the phenyl rings contributes to its reactivity and potential applications in organic synthesis and materials science. The carbonitrile functional group imparts significant polarity and can participate in various chemical reactions, including nucleophilic additions and cycloadditions. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of other complex organic molecules. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock.

Formula: C₁₃H₈N₂O₂

InChI: InChI=1S/C13H8N2O2/c14-9-10-2-1-3-12(8-10)11-4-6-13(7-5-11)15(16)17/h1-8H

InChI key: InChIKey=PLVVAOSJIWCLTE-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C(C2=CC=C(N(=O)=O)C=C2)C=CC1

Synonyms:

• [1,1′-Biphenyl]-3-carbonitrile, 4′-nitro-
• 4′-Nitro[1,1′-biphenyl]-3-carbonitrile

3-(4-Nitrophenyl)benzonitrile

CAS: 1352318-54-7

Formula: C₁₃H₈N₂O₂

Molecular weight: 224.2148

Ref: IN-DA007ZO7