CAS 1352318-62-7
:3-(6-Chloro-2-methyl-3-pyridinyl)benzoic acid
Description:
3-(6-Chloro-2-methyl-3-pyridinyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a pyridine ring. The presence of a chlorine atom and a methyl group on the pyridine ring contributes to its chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic systems. It is likely to participate in various chemical reactions, including electrophilic aromatic substitution and carboxylic acid reactions, owing to the functional groups present. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its specific melting point, boiling point, and other physical properties would depend on the purity and form of the substance. Safety data should be consulted to understand its handling and potential hazards, as with any chemical compound.
Formula:C13H10ClNO2
InChI:InChI=1S/C13H10ClNO2/c1-8-11(5-6-12(14)15-8)9-3-2-4-10(7-9)13(16)17/h2-7H,1H3,(H,16,17)
InChI key:InChIKey=XJSGTLSFLZGTPN-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(C(O)=O)=CC=C2)C=CC(Cl)=N1
Synonyms:- 3-(6-Chloro-2-methyl-3-pyridinyl)benzoic acid
- Benzoic acid, 3-(6-chloro-2-methyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.