CymitQuimica logo

CAS 1352318-64-9

:

3-Pyridinecarbonitrile, 2-(4-aminophenyl)-

Description:
3-Pyridinecarbonitrile, 2-(4-aminophenyl)- is an organic compound characterized by its pyridine and carbonitrile functional groups, along with an aniline moiety. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for coordination with metal ions. The presence of the carbonitrile group (-C≡N) indicates a strong electron-withdrawing characteristic, which can influence the compound's reactivity and polarity. The 4-aminophenyl substituent introduces an amino group (-NH2) that can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents. This structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 3-Pyridinecarbonitrile, 2-(4-aminophenyl)- is a versatile compound with potential utility in various chemical applications.
Formula:C12H9N3
InChI:InChI=1S/C12H9N3/c13-8-10-2-1-7-15-12(10)9-3-5-11(14)6-4-9/h1-7H,14H2
InChI key:InChIKey=DDJPEVWWWXBZNH-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=CC=C1)C2=CC=C(N)C=C2
Synonyms:
  • 3-Pyridinecarbonitrile, 2-(4-aminophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.