CAS 1352318-67-2

Methyl 5-fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylate

Description:

Methyl 5-fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylate is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a nitro group (-NO2) and a fluoro group (-F) on the biphenyl framework contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The carboxylate functional group (-COOCH3) indicates that it is an ester, which can influence its solubility and reactivity. This compound may exhibit interesting electronic properties due to the electron-withdrawing effects of the nitro and fluoro substituents, potentially making it useful in the development of pharmaceuticals or agrochemicals. Additionally, the presence of these functional groups can affect its biological activity, making it a candidate for further research in drug discovery. Overall, Methyl 5-fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylate is a compound of interest in various fields of chemistry, particularly in the synthesis of more complex organic molecules.

Formula: C₁₄H₁₀FNO₄

InChI: InChI=1S/C14H10FNO4/c1-20-14(17)11-6-10(7-12(15)8-11)9-2-4-13(5-3-9)16(18)19/h2-8H,1H3

InChI key: InChIKey=ISEQOKFPRSUJQL-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=C(F)C1)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• Methyl 5-fluoro-4′-nitro[1,1′-biphenyl]-3-carboxylate
• [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-4′-nitro-, methyl ester

Methyl 3-fluoro-5-(4-nitrophenyl)benzoate

CAS: 1352318-67-2

Formula: C₁₄H₁₀FNO₄

Molecular weight: 275.2319

Ref: IN-DA009WLV