CAS 1352318-68-3

2(1H)-Pyridinone, 3-(4-aminophenyl)-

Description:

2(1H)-Pyridinone, 3-(4-aminophenyl)-, identified by its CAS number 1352318-68-3, is an organic compound characterized by a pyridinone core structure with an amino group attached to a phenyl ring. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of both the pyridinone and amino functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and potential interactions with biological targets. The compound may also display biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of the pyridinone moiety may contribute to its stability and reactivity under various conditions. Overall, 2(1H)-Pyridinone, 3-(4-aminophenyl)- is a compound with unique characteristics that warrant further investigation for its potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1S/C11H10N2O/c12-9-5-3-8(4-6-9)10-2-1-7-13-11(10)14/h1-7H,12H2,(H,13,14)

InChI key: InChIKey=KSCAQADHMMVACL-UHFFFAOYSA-N

SMILES: O=C1C(C2=CC=C(N)C=C2)=CC=CN1

Synonyms:

• 2(1H)-Pyridinone, 3-(4-aminophenyl)-