CAS 1352318-71-8

4′-(Ethoxycarbonyl)[1,1′-biphenyl]-3-acetic acid

Description:

4′-(Ethoxycarbonyl)[1,1′-biphenyl]-3-acetic acid, identified by its CAS number 1352318-71-8, is an organic compound characterized by its biphenyl structure substituted with an ethoxycarbonyl group and an acetic acid moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The ethoxycarbonyl group contributes to its solubility in organic solvents, while the acetic acid component can impart acidic characteristics, allowing for potential interactions in biochemical contexts. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and potential applications in organic synthesis or as a pharmaceutical intermediate. Additionally, the presence of multiple functional groups may allow for further derivatization, making it a versatile compound in chemical research and development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₆O₄

InChI: InChI=1S/C17H16O4/c1-2-21-17(20)14-8-6-13(7-9-14)15-5-3-4-12(10-15)11-16(18)19/h3-10H,2,11H2,1H3,(H,18,19)

InChI key: InChIKey=UBNHYPLAFHZYCO-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=C(C=CC1)C2=CC=C(C(OCC)=O)C=C2

Synonyms:

• 4′-(Ethoxycarbonyl)[1,1′-biphenyl]-3-acetic acid
• [1,1′-Biphenyl]-3-acetic acid, 4′-(ethoxycarbonyl)-