CymitQuimica logo

CAS 1352393-61-3

:

6,7-Difluoro-3,4-dihydro-1(2H)-isoquinolinone

Description:
6,7-Difluoro-3,4-dihydro-1(2H)-isoquinolinone is a chemical compound characterized by its unique bicyclic structure, which includes a fused isoquinoline ring system. This compound features two fluorine atoms substituted at the 6 and 7 positions of the isoquinolinone framework, contributing to its distinct chemical properties. The presence of the fluorine atoms can enhance the compound's lipophilicity and influence its reactivity, making it of interest in medicinal chemistry and drug design. The dihydro form indicates that the compound has a saturated ring, which can affect its stability and interaction with biological targets. Additionally, the isoquinolinone moiety is often associated with various pharmacological activities, including potential neuroprotective and anti-inflammatory effects. The compound's CAS number, 1352393-61-3, allows for precise identification and retrieval of information in chemical databases. Overall, 6,7-Difluoro-3,4-dihydro-1(2H)-isoquinolinone represents a valuable structure for further research and development in the field of organic and medicinal chemistry.
Formula:C9H7F2NO
InChI:InChI=1S/C9H7F2NO/c10-7-3-5-1-2-12-9(13)6(5)4-8(7)11/h3-4H,1-2H2,(H,12,13)
InChI key:InChIKey=QCFLRJVEUDYCCP-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(F)=C(F)C2)CCN1
Synonyms:
  • 1(2H)-Isoquinolinone, 6,7-difluoro-3,4-dihydro-
  • 6,7-Difluoro-3,4-dihydroisoquinolin-1(2H)-one
  • 6,7-Difluoro-3,4-dihydro-1(2H)-isoquinolinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.