CAS 1352393-65-7
:4-bromo-5-methoxy-7-methyl-1H-Indole
Description:
4-Bromo-5-methoxy-7-methyl-1H-indole is a chemical compound belonging to the indole family, which is characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This specific compound features a bromine atom at the 4-position, a methoxy group (-OCH3) at the 5-position, and a methyl group (-CH3) at the 7-position of the indole ring. These substituents can significantly influence the compound's chemical reactivity, solubility, and biological activity. Generally, indole derivatives are known for their diverse pharmacological properties, including potential applications in medicinal chemistry. The presence of the bromine atom may enhance the compound's reactivity and facilitate further chemical modifications. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially influencing its interaction with biological targets. Overall, 4-bromo-5-methoxy-7-methyl-1H-indole is of interest in research contexts, particularly in studies related to drug development and organic synthesis.
Formula:C10H10BrNO
InChI:InChI=1S/C10H10BrNO/c1-6-5-8(13-2)9(11)7-3-4-12-10(6)7/h3-5,12H,1-2H3
InChI key:InChIKey=NZBDVOBNQVAKPI-UHFFFAOYSA-N
SMILES:BrC1=C2C(=C(C)C=C1OC)NC=C2
Synonyms:- 4-BroMo-5-Methoxy-7-Methylindole
- 4-Bromo-5-methoxy-7-methyl-1H-indole
- 1H-Indole, 4-bromo-5-methoxy-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.