CymitQuimica logo

CAS 1352393-66-8

:

4-Fluoro-5-methoxy-1H-indazole

Description:
4-Fluoro-5-methoxy-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a fluorine atom at the 4-position and a methoxy group at the 5-position contributes to its unique chemical properties. This compound is typically classified as a heterocyclic aromatic compound due to the inclusion of nitrogen atoms in its structure. It may exhibit various biological activities, making it of interest in pharmaceutical research. The methoxy group can influence the compound's solubility and reactivity, while the fluorine atom can enhance its metabolic stability and lipophilicity. Additionally, 4-Fluoro-5-methoxy-1H-indazole may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. Its specific applications and interactions would depend on ongoing research and development in medicinal chemistry and related fields.
Formula:C8H7FN2O
InChI:InChI=1S/C8H7FN2O/c1-12-7-3-2-6-5(8(7)9)4-10-11-6/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=BNQGZTLARNSVTJ-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=C1OC)NN=C2
Synonyms:
  • 1H-Indazole, 4-fluoro-5-methoxy-
  • 4-Fluoro-5-methoxy-1H-indazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.