
CAS 1352394-37-6
:1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 3-fluoro-
Description:
1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 3-fluoro- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may serve as a precursor for various chemical transformations. The 3-fluoro substitution introduces a fluorine atom at the third position of the pyridine ring, which can influence the compound's reactivity, polarity, and biological activity. This compound is of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its structural features may allow for interactions with biological targets, making it a candidate for further research in therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be affected by the presence of the fluorine atom and the carboxylic acid group, which are important considerations in its practical applications.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-5-3-10-7-4(5)1-2-6(11-7)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=AXAAJMOZXCKWEM-UHFFFAOYSA-N
SMILES:FC=1C=2C(=NC(C(O)=O)=CC2)NC1
Synonyms:- 3-Fluoro-7-azaindole-6-carboxylic acid
- 3-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carboxylic acid
- 1H-Pyrrolo[2,3-b]pyridine-6-carboxylic acid, 3-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.