CymitQuimica logo

CAS 1352394-84-3

:

4-Bromo-1,2-benzisoxazole-3-carboxylic acid

Description:
4-Bromo-1,2-benzisoxazole-3-carboxylic acid is a heterocyclic organic compound characterized by the presence of a bromine atom, a benzisoxazole ring, and a carboxylic acid functional group. This compound typically exhibits a crystalline solid form and is soluble in polar solvents, which is common for carboxylic acids. The bromine substituent can influence its reactivity and biological activity, potentially enhancing its role in medicinal chemistry. The benzisoxazole moiety contributes to its aromatic character and can participate in various chemical reactions, such as electrophilic substitutions. The carboxylic acid group provides acidic properties, allowing for proton donation in solution, which can affect its interactions with other molecules. This compound may be of interest in pharmaceutical research due to its potential biological activities, including antimicrobial or anti-inflammatory properties. Its unique structure allows for various synthetic modifications, making it a valuable intermediate in organic synthesis and drug development. As with any chemical substance, proper handling and safety precautions should be observed due to its potential hazards.
Formula:C8H4BrNO3
InChI:InChI=1S/C8H4BrNO3/c9-4-2-1-3-5-6(4)7(8(11)12)10-13-5/h1-3H,(H,11,12)
InChI key:InChIKey=USXNLPWCAJHNDQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(ON1)=CC=CC2Br
Synonyms:
  • 4-Bromo-1,2-benzisoxazole-3-carboxylic acid
  • 1,2-Benzisoxazole-3-carboxylic acid, 4-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.