
CAS 1352394-93-4
:1,2,3,4-Tetrahydro-1-oxo-8-isoquinolinecarbonitrile
Description:
1,2,3,4-Tetrahydro-1-oxo-8-isoquinolinecarbonitrile is a chemical compound characterized by its unique bicyclic structure, which includes a tetrahydroisoquinoline framework. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the carbonyl group (oxo) enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic additions. The compound's molecular structure suggests it may exhibit biological activity, potentially serving as a lead compound in drug discovery. Its solubility and stability can vary depending on the solvent and conditions, which are important factors to consider in practical applications. Additionally, the compound's CAS number, 1352394-93-4, allows for precise identification and retrieval of information in chemical databases. Overall, 1,2,3,4-Tetrahydro-1-oxo-8-isoquinolinecarbonitrile represents a versatile structure with implications in both synthetic and pharmaceutical chemistry.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c11-6-8-3-1-2-7-4-5-12-10(13)9(7)8/h1-3H,4-5H2,(H,12,13)
InChI key:InChIKey=FUNXZWRAQLILLY-UHFFFAOYSA-N
SMILES:C(#N)C1=C2C(=CC=C1)CCNC2=O
Synonyms:- 8-Isoquinolinecarbonitrile, 1,2,3,4-tetrahydro-1-oxo-
- 1,2,3,4-Tetrahydro-1-oxo-8-isoquinolinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.