
CAS 1352394-94-5
:4-Bromo-3-fluoro-1H-pyrrolo[2,3-c]pyridine
Description:
4-Bromo-3-fluoro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and fluorine substituents introduces significant electronegativity and steric effects, influencing its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a planar structure, enhancing its ability to participate in π-π stacking interactions, which can be beneficial in drug design and development. Its molecular framework allows for various functionalization possibilities, making it a versatile intermediate in synthetic organic chemistry. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, which are crucial for its practical applications. Overall, 4-Bromo-3-fluoro-1H-pyrrolo[2,3-c]pyridine is of interest for its potential biological activity and utility in the synthesis of more complex molecules.
Formula:C7H4BrFN2
InChI:InChI=1S/C7H4BrFN2/c8-4-1-10-3-6-7(4)5(9)2-11-6/h1-3,11H
InChI key:InChIKey=NVTYEDLZFXWRKD-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CN=C1)NC=C2F
Synonyms:- 1H-Pyrrolo[2,3-c]pyridine, 4-bromo-3-fluoro-
- 4-Bromo-3-fluoro-1H-pyrrolo[2,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.