CAS 1352395-14-2

4-Methyl-5-nitro-3-pyridinamine

Description:

4-Methyl-5-nitro-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methyl group at the 4-position and a nitro group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The nitro group is known for its electron-withdrawing properties, which can influence the reactivity of the compound in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in the development of agrochemicals or pharmaceuticals, although specific applications would depend on further research into its biological properties and reactivity. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive and potentially hazardous.

Formula: C₆H₇N₃O₂

InChI: InChI=1S/C6H7N3O2/c1-4-5(7)2-8-3-6(4)9(10)11/h2-3H,7H2,1H3

InChI key: InChIKey=OPKPHHCBKIOJQM-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(C)=C(N)C=NC1

Synonyms:

• 3-Pyridinamine, 4-methyl-5-nitro-
• 4-Methyl-5-nitro-3-pyridinamine