CAS 1352395-15-3

5-Aminopyrazolo[1,5-a]pyridine-3-carboxylic acid

Description:

5-Aminopyrazolo[1,5-a]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures, which contribute to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it a potential candidate for various biological activities and applications in medicinal chemistry. Its molecular structure allows for hydrogen bonding, which can influence its solubility and reactivity. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the amino group may engage in nucleophilic interactions. This compound is of interest in research related to pharmaceuticals, particularly in the development of new therapeutic agents targeting specific biological pathways. Additionally, its structural characteristics may allow for modifications that could enhance its efficacy or selectivity in biological systems. Overall, 5-Aminopyrazolo[1,5-a]pyridine-3-carboxylic acid represents a versatile scaffold for further exploration in chemical and biological research.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c9-5-1-2-11-7(3-5)6(4-10-11)8(12)13/h1-4H,9H2,(H,12,13)

InChI key: InChIKey=HDFMKHWLGQHWEF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(N=C1)C=CC(N)=C2

Synonyms:

• Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 5-amino-
• 5-Aminopyrazolo[1,5-a]pyridine-3-carboxylic acid

5-Aminopyrazolo[1,5-a]pyridine-3-carboxylic acid

CAS: 1352395-15-3

Versatile small molecule scaffold

Formula: C₈H₇N₃O₂

Purity: Min. 95%

Molecular weight: 177.16 g/mol

Ref: 3D-CEC39515