CAS 1352395-22-2

1H-Pyrrolo[3,2-b]pyridine-7-carboxylic acid, 3-amino-6-bromo-, hydrochloride (1:1)

Description:

1H-Pyrrolo[3,2-b]pyridine-7-carboxylic acid, 3-amino-6-bromo-, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a bioactive molecule. The presence of a bromine atom at the 6-position enhances its reactivity and may influence its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in biological studies or pharmaceutical applications. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Its specific interactions and biological activities would depend on the context of its use, including the target systems and conditions. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents, which can exhibit varying degrees of toxicity.

Formula: C₈H₆BrN₃O₂·ClH

InChI: InChI=1S/C8H6BrN3O2.ClH/c9-3-1-11-6-4(10)2-12-7(6)5(3)8(13)14;/h1-2,12H,10H2,(H,13,14);1H

InChI key: InChIKey=LQJSGBKXWZYWPD-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C(N)=CN2)=NC=C1Br.Cl

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-7-carboxylic acid, 3-amino-6-bromo-, hydrochloride (1:1)