CymitQuimica logo

CAS 1352395-46-0

:

6-(Trifluoromethyl)-1H-indazol-4-amine

Description:
6-(Trifluoromethyl)-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) at the 6-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The amine functional group at the 4-position contributes to its reactivity, allowing for various substitution reactions. This compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. Its unique structure may impart specific pharmacological properties, making it of interest in the fields of pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group can enhance metabolic stability and bioavailability. As with many fluorinated compounds, it may exhibit distinct solubility and partitioning behavior in biological systems, which is crucial for understanding its efficacy and safety profile in potential applications.
Formula:C8H6F3N3
InChI:InChI=1S/C8H6F3N3/c9-8(10,11)4-1-6(12)5-3-13-14-7(5)2-4/h1-3H,12H2,(H,13,14)
InChI key:InChIKey=IHQAYTCBMNCOKS-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(C(F)(F)F)=C1)NN=C2
Synonyms:
  • 6-(Trifluoromethyl)-1H-indazol-4-amine
  • 1H-Indazol-4-amine, 6-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.