
CAS 1352395-90-4
:3-Bromo-1H-pyrazolo[4,3-b]pyridine-6-carboxylic acid
Description:
3-Bromo-1H-pyrazolo[4,3-b]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both bromine and carboxylic acid functional groups. This compound features a bromine atom at the 3-position of the pyrazolo ring, contributing to its reactivity and potential applications in medicinal chemistry. The carboxylic acid group at the 6-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. The presence of the pyrazole moiety suggests potential biological activity, making it a candidate for drug development. Additionally, the compound's unique structure may allow for interactions with biological targets, which is of interest in the fields of pharmacology and biochemistry. Its CAS number, 1352395-90-4, serves as a unique identifier for regulatory and research purposes. Overall, this compound's characteristics make it a valuable subject for further investigation in synthetic and medicinal chemistry.
Formula:C7H4BrN3O2
InChI:InChI=1S/C7H4BrN3O2/c8-6-5-4(10-11-6)1-3(2-9-5)7(12)13/h1-2H,(H,10,11)(H,12,13)
InChI key:InChIKey=WZIGHCCEVBDSNR-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC(C(O)=O)=CN2)NN1
Synonyms:- 3-Bromo-1H-pyrazolo[4,3-b]pyridine-6-carboxylic acid
- 1H-Pyrazolo[4,3-b]pyridine-6-carboxylic acid, 3-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.