CAS 1352396-17-8

2-Methyl-1,3-dinitro-5-(phenylmethoxy)benzene

Description:

2-Methyl-1,3-dinitro-5-(phenylmethoxy)benzene is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two nitro groups, a methyl group, and a phenylmethoxy group. The presence of the nitro groups indicates that this compound may exhibit significant reactivity, particularly in electrophilic aromatic substitution reactions. The methyl group contributes to the compound's hydrophobic characteristics, while the phenylmethoxy group enhances its solubility in organic solvents. This compound may also display interesting electronic properties due to the electron-withdrawing nature of the nitro groups, which can influence its reactivity and stability. Additionally, the presence of multiple functional groups suggests potential applications in materials science or as intermediates in organic synthesis. However, due to the presence of nitro groups, it is essential to handle this compound with care, as nitro compounds can be sensitive to heat and shock, potentially posing safety risks. Overall, 2-Methyl-1,3-dinitro-5-(phenylmethoxy)benzene is a notable compound in the realm of organic chemistry.

Formula: C₁₄H₁₂N₂O₅

InChI: InChI=1S/C14H12N2O5/c1-10-13(15(17)18)7-12(8-14(10)16(19)20)21-9-11-5-3-2-4-6-11/h2-8H,9H2,1H3

InChI key: InChIKey=PGFLGHVZCWIPMP-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=CC(N(=O)=O)=C(C)C(N(=O)=O)=C2

Synonyms:

• Benzene, 2-methyl-1,3-dinitro-5-(phenylmethoxy)-
• 2-Methyl-1,3-dinitro-5-(phenylmethoxy)benzene