
CAS 1352397-25-1
:Ethyl 7-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxylate
Description:
Ethyl 7-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyridine structure, which combines features of both pyrazole and pyridine rings. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating functional groups such as an ethyl ester and a methoxy group. The presence of the methoxy group contributes to its potential solubility in organic solvents and may influence its reactivity and biological activity. Ethyl 7-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxylate is of interest in medicinal chemistry, as compounds with similar structures have been investigated for various pharmacological properties, including anti-inflammatory and analgesic effects. Its synthesis often involves multi-step organic reactions, and its characterization can be achieved through techniques such as NMR spectroscopy and mass spectrometry. As with many chemical substances, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C12H14N2O3
InChI:InChI=1S/C12H14N2O3/c1-4-17-12(15)11-8(2)13-14-9(11)6-5-7-10(14)16-3/h5-7H,4H2,1-3H3
InChI key:InChIKey=LFLNCKNIKWNCGZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(C(OC)=CC=C2)N=C1C
Synonyms:- Ethyl 7-methoxy-2-methylpyrazolo[1,5-a]pyridine-3-carboxylate
- Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 7-methoxy-2-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.