CAS 1352397-95-5

Methyl 3-bromo-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylate

Description:

Methyl 3-bromo-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both bromine and methyl functional groups. This compound features a bromine atom at the 3-position and a methyl group at the 7-position of the pyrazolo ring, contributing to its reactivity and potential biological activity. The carboxylate ester functional group, derived from methyl esterification, enhances its solubility in organic solvents and may influence its pharmacokinetic properties. The presence of the pyrazolo and pyrimidine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its molecular structure may allow for interactions with specific enzymes or receptors, making it a candidate for further investigation in drug discovery. As with many brominated compounds, it may exhibit unique properties such as increased lipophilicity and potential bioactivity, warranting further study to elucidate its mechanisms of action and therapeutic potential.

Formula: C₉H₈BrN₃O₂

InChI: InChI=1S/C9H8BrN3O2/c1-5-3-7(9(14)15-2)12-8-6(10)4-11-13(5)8/h3-4H,1-2H3

InChI key: InChIKey=MNMVMQXBDHCZPZ-UHFFFAOYSA-N

SMILES: BrC1=C2N(C(C)=CC(C(OC)=O)=N2)N=C1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 3-bromo-7-methyl-, methyl ester
• Methyl 3-bromo-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylate